Boronic acid derivatives
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Combi-Blocks | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 100g | 117520819
4-Cyanophenylboronic acid | Combi-Blocks | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 100g | 117520819
Accela Chembio Inc MF: C8H9O4B | MW: 179.97 | >97% | Flash Point: 170.9 celsius | BP: 359 celsius at 760 mmHg.
MF: C8H9O4B | MW: 179.97 | >97% | Flash Point: 170.9 celsius | BP: 359 celsius at 760 mmHg.
Medchemexpress LLC Metaproterenol hemisulfate | 5874-97-5 | MFCD00058303 | 99.4% | 1 ML
Metaproterenol hemisulfate from MedChemExpress is a direct-acting sympathomimetic and a β2-adrenergic receptor (β2AR) agonist. It also exhibits anti-inflammatory activity and is for research use only.
- Direct-acting sympathomimetic
- β2-adrenergic receptor (β2AR) agonist
- Exhibits anti-inflammatory activity
- Enhances β-arrestin2 and its interaction with IκBα
- Downregulates NF-κB
- Attenuates monocyte activation and pro-inflammatory and pro-fibrotic responses in the kidneys and heart
- Potential protective effects against diabetic renal and cardiovascular complications
Aobchem 3-Formyl-4-Nitrophenylboronic acid pinacol ester | ≥97% | CAS 1184259-08-2 | C13H16BNO5 | 1g
3-Formyl-4-Nitrophenylboronic acid pinacol ester | ≥97% | CAS 1184259-08-2 | C13H16BNO5 | 1g
eMolecules 480424-70-2 | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | Ambeed | MFCD03453060 | 262.110 | C14H19BO4 | 95.000 | CC(=O)Oc1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 1g | 525046632
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | Ambeed | 480424-70-2 | MFCD03453060 | 262.110 | C14H19BO4 | 95.000 | CC(=O)Oc1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 1g | 525046632
Cambridge Isotope Laboratories Dioxin Furan Food/Feed/QQQ Calibration Standard (CS5) 0 25 mL
Dioxin Furan Food/Feed/QQQ Calibration Standard (CS5) 0 25 mL
eMolecules 2-PHENOXYPYRIDINE-4-BORONIC ACID | 1451393-41-1 | MFCD22543657 | 1g
AstaTech | 2-PHENOXYPYRIDINE-4-BORONIC ACID | 1g | 596058519 | F15559 | 98.000 | 1451393-41-1 | MFCD22543657 | 215.020 | C11H10BNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 947533-25-7 | 3-Cyanomethoxyphenylboronic acid | Combi-Blocks | MFCD09908169 | 176.970 | C8H8BNO3 | 95.000 | OB(O)c1cccc(OCC#N)c1 | 1g | 117526276
3-Cyanomethoxyphenylboronic acid | Combi-Blocks | 947533-25-7 | MFCD09908169 | 176.970 | C8H8BNO3 | 95.000 | OB(O)c1cccc(OCC#N)c1 | 1g | 117526276
eMolecules 1072946-64-5 | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | MFCD11053857 | 230.940 | C8H5BF3NO3 | 97.000 | OB(O)c1cc(ccc1OC(F)(F)F)C#N | 1g | 117523929
5-Cyano-2-(trifluoromethoxy)phenylboronic acid | Combi-Blocks | 1072946-64-5 | MFCD11053857 | 230.940 | C8H5BF3NO3 | 97.000 | OB(O)c1cc(ccc1OC(F)(F)F)C#N | 1g | 117523929
Chemscene ChemScene | (1H-Indol-5-yl)boronic acid | 10G | CS-W020721 | 0.98 | 144104-59-6| MFCD01319013 | 160.97
ChemScene | (1H-Indol-5-yl)boronic acid | 10G | CS-W020721 | 0.98 | 144104-59-6| MFCD01319013 | 160.97
![eMolecules 256-81-5 | 5H-Dibenzo[a,d]cycloheptene | MFCD00228674 | 250mg](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502174747.JPG-250.jpg)
eMolecules 256-81-5 | 5H-Dibenzo[a,d]cycloheptene | MFCD00228674 | 250mg
ChemScene | Ethyl 4-bromopicolinate | 1g | 536787698 | CS-0041851 | 62150-47-4 | MFCD09839150 | 230.061 | C8H8BrNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 768-35-4 | 3-Fluorophenylboronic acid | Chem-Impex | MFCD00236042 | 139.920 | C6H6BFO2 | 99.000 | OB(O)c1cccc(F)c1 | 250g | 510431993
3-Fluorophenylboronic acid | Chem-Impex | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 99.000 | OB(O)c1cccc(F)c1 | 250g | 510431993